C13H22FN3O4S2 — CID 119983247
N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 119983247) has the molecular formula C13H22FN3O4S2 and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 119983247 |
| Molecular Formula | C13H22FN3O4S2 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-fluoro-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C13H22FN3O4S2/c1-9(2)6-10(8-15)16-23(20,21)11-4-5-13(12(14)7-11)17-22(3,18)19/h4-5,7,9-10,16-17H,6,8,15H2,1-3H3 |
| InChIKey | JBALTWHBXZMDME-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |