C12H20ClFN2O2S — CID 119983189
N-(1-amino-4-methylpentan-2-yl)-2-fluorobenzenesulfonamide;hydrochloride (PubChem CID 119983189) has the molecular formula C12H20ClFN2O2S and a molecular weight of 310.82 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983189 |
| Molecular Formula | C12H20ClFN2O2S |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-fluorobenzenesulfonamide;hydrochloride |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1ccccc1F.Cl |
| InChI | InChI=1S/C12H19FN2O2S.ClH/c1-9(2)7-10(8-14)15-18(16,17)12-6-4-3-5-11(12)13;/h3-6,9-10,15H,7-8,14H2,1-2H3;1H |
| InChIKey | UWJUOACOSFSXMJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |