C12H19Cl2FN2O2S — CID 119983149
N-(1-amino-4-methylpentan-2-yl)-3-chloro-2-fluorobenzenesulfonamide;hydrochloride (PubChem CID 119983149) has the molecular formula C12H19Cl2FN2O2S and a molecular weight of 345.27 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-chloro-2-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-2-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983149 |
| Molecular Formula | C12H19Cl2FN2O2S |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-2-fluorobenzenesulfonamide;hydrochloride |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1cccc(Cl)c1F.Cl |
| InChI | InChI=1S/C12H18ClFN2O2S.ClH/c1-8(2)6-9(7-15)16-19(17,18)11-5-3-4-10(13)12(11)14;/h3-5,8-9,16H,6-7,15H2,1-2H3;1H |
| InChIKey | GPWIEESYUVTFKU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |