C13H18ClF3N2O2S — CID 124682011
N-[(2S)-1-amino-4-methylpentan-2-yl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 124682011) has the molecular formula C13H18ClF3N2O2S and a molecular weight of 358.81 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-methylpentan-2-yl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(2S)-1-amino-4-methylpentan-2-yl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 124682011 |
| Molecular Formula | C13H18ClF3N2O2S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[(2S)-1-amino-4-methylpentan-2-yl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)C[C@@H](CN)NS(=O)(=O)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H18ClF3N2O2S/c1-8(2)5-10(7-18)19-22(20,21)12-4-3-9(6-11(12)14)13(15,16)17/h3-4,6,8,10,19H,5,7,18H2,1-2H3/t10-/m0/s1 |
| InChIKey | QZLIGZGARIDPJK-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |