C14H21ClFN3O3S — CID 119983105
N-[4-[(1-amino-4-methylpentan-2-yl)sulfamoyl]-2-chloro-5-fluorophenyl]acetamide (PubChem CID 119983105) has the molecular formula C14H21ClFN3O3S and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[4-[(1-amino-4-methylpentan-2-yl)sulfamoyl]-2-chloro-5-fluorophenyl]acetamide.
| Compound Name | N-[4-[(1-amino-4-methylpentan-2-yl)sulfamoyl]-2-chloro-5-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 119983105 |
| Molecular Formula | C14H21ClFN3O3S |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[4-[(1-amino-4-methylpentan-2-yl)sulfamoyl]-2-chloro-5-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(S(=O)(=O)NC(CN)CC(C)C)cc1Cl |
| InChI | InChI=1S/C14H21ClFN3O3S/c1-8(2)4-10(7-17)19-23(21,22)14-5-11(15)13(6-12(14)16)18-9(3)20/h5-6,8,10,19H,4,7,17H2,1-3H3,(H,18,20) |
| InChIKey | ADOOXBAAFVPBFT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |