C13H18ClN3O2S — CID 115752456
N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide (PubChem CID 115752456) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 115752456 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-9(2)5-11(8-16)17-20(18,19)12-4-3-10(7-15)13(14)6-12/h3-4,6,9,11,17H,5,8,16H2,1-2H3 |
| InChIKey | DXORMSLTHCNVGF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |