C13H19Cl2N3O2S — CID 119983339
N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide;hydrochloride (PubChem CID 119983339) has the molecular formula C13H19Cl2N3O2S and a molecular weight of 352.29 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983339 |
| Molecular Formula | C13H19Cl2N3O2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-chloro-4-cyanobenzenesulfonamide;hydrochloride |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1ccc(C#N)c(Cl)c1.Cl |
| InChI | InChI=1S/C13H18ClN3O2S.ClH/c1-9(2)5-11(8-16)17-20(18,19)12-4-3-10(7-15)13(14)6-12;/h3-4,6,9,11,17H,5,8,16H2,1-2H3;1H |
| InChIKey | SHJXYIPLZXPKDL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |