C14H25ClN2O2S — CID 119983421
N-(1-amino-4-methylpentan-2-yl)-3-ethylbenzenesulfonamide;hydrochloride (PubChem CID 119983421) has the molecular formula C14H25ClN2O2S and a molecular weight of 320.89 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-ethylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-ethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983421 |
| Molecular Formula | C14H25ClN2O2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-ethylbenzenesulfonamide;hydrochloride |
| SMILES | CCc1cccc(S(=O)(=O)NC(CN)CC(C)C)c1.Cl |
| InChI | InChI=1S/C14H24N2O2S.ClH/c1-4-12-6-5-7-14(9-12)19(17,18)16-13(10-15)8-11(2)3;/h5-7,9,11,13,16H,4,8,10,15H2,1-3H3;1H |
| InChIKey | HXMIMFRWEXVAMZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |