C7H6Cl2N2S — CID 722776
(2,6-dichlorophenyl)thiourea (PubChem CID 722776) has the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. Its IUPAC name is (2,6-dichlorophenyl)thiourea.
| Compound Name | (2,6-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 722776 |
| Molecular Formula | C7H6Cl2N2S |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | (2,6-dichlorophenyl)thiourea |
| SMILES | NC(=S)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H6Cl2N2S/c8-4-2-1-3-5(9)6(4)11-7(10)12/h1-3H,(H3,10,11,12) |
| InChIKey | KUQHRGMPBWZVQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|