C8H6Cl2N2OS — CID 98040700
2-(2,6-dichloroanilino)-2-sulfanylideneacetamide (PubChem CID 98040700) has the molecular formula C8H6Cl2N2OS and a molecular weight of 249.12 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-2-sulfanylideneacetamide.
| Compound Name | 2-(2,6-dichloroanilino)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 98040700 |
| Molecular Formula | C8H6Cl2N2OS |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-(2,6-dichloroanilino)-2-sulfanylideneacetamide |
| SMILES | NC(=O)C(=S)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H6Cl2N2OS/c9-4-2-1-3-5(10)6(4)12-8(14)7(11)13/h1-3H,(H2,11,13)(H,12,14) |
| InChIKey | SUWDWHLUGHIITN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|