C12H7Cl4N — CID 101290830
2,3,5-trichloro-N-(2-chlorophenyl)aniline (PubChem CID 101290830) has the molecular formula C12H7Cl4N and a molecular weight of 307.01 g/mol. Its IUPAC name is 2,3,5-trichloro-N-(2-chlorophenyl)aniline.
| Compound Name | 2,3,5-trichloro-N-(2-chlorophenyl)aniline |
|---|---|
| PubChem CID | 101290830 |
| Molecular Formula | C12H7Cl4N |
| Molecular Weight | 307.01 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | 2,3,5-trichloro-N-(2-chlorophenyl)aniline |
| SMILES | Clc1cc(Cl)c(Cl)c(Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C12H7Cl4N/c13-7-5-9(15)12(16)11(6-7)17-10-4-2-1-3-8(10)14/h1-6,17H |
| InChIKey | APGPVSYJMJYUBA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.01 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|