About 1-chloro-2-methylbenzene;ethene
1-chloro-2-methylbenzene;ethene (PubChem CID 142088810) has the molecular formula C9H11Cl
and a molecular weight of 154.64 g/mol. Its IUPAC name is 1-chloro-2-methylbenzene;ethene.
Molecular Properties
| Compound Name | 1-chloro-2-methylbenzene;ethene |
| PubChem CID | 142088810 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 1-chloro-2-methylbenzene;ethene |
| SMILES | C=C.Cc1ccccc1Cl |
| InChI | InChI=1S/C7H7Cl.C2H4/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1-2H2 |
| InChIKey | SLTOQYZVUXERCN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-methylbenzene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methylbenzene;ethene?
The IUPAC name of 1-chloro-2-methylbenzene;ethene (CID 142088810) is 1-chloro-2-methylbenzene;ethene.
What is the SMILES notation for 1-chloro-2-methylbenzene;ethene?
The canonical SMILES for 1-chloro-2-methylbenzene;ethene is C=C.Cc1ccccc1Cl.
What is the InChIKey of 1-chloro-2-methylbenzene;ethene?
The InChIKey is SLTOQYZVUXERCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.C2H4/c1-6-4-2-3-5-7(6)8;1-2/h2-5H,1H3;1-2H2.
What are the key properties of 1-chloro-2-methylbenzene;ethene?
1-chloro-2-methylbenzene;ethene has a molecular weight of 154.64 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methylbenzene;ethene is sourced from PubChem (CID 142088810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).