About 1-chloro-2-methylbenzene;ethane;methylcyclopentane
1-chloro-2-methylbenzene;ethane;methylcyclopentane (PubChem CID 164862819) has the molecular formula C15H25Cl
and a molecular weight of 240.82 g/mol. Its IUPAC name is 1-chloro-2-methylbenzene;ethane;methylcyclopentane.
Molecular Properties
| Compound Name | 1-chloro-2-methylbenzene;ethane;methylcyclopentane |
| PubChem CID | 164862819 |
| Molecular Formula | C15H25Cl |
| Molecular Weight | 240.82 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-chloro-2-methylbenzene;ethane;methylcyclopentane |
| SMILES | CC.CC1CCCC1.Cc1ccccc1Cl |
| InChI | InChI=1S/C7H7Cl.C6H12.C2H6/c1-6-4-2-3-5-7(6)8;1-6-4-2-3-5-6;1-2/h2-5H,1H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | PCJRVQFQRCOQMD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.82 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-methylbenzene;ethane;methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methylbenzene;ethane;methylcyclopentane?
The IUPAC name of 1-chloro-2-methylbenzene;ethane;methylcyclopentane (CID 164862819) is 1-chloro-2-methylbenzene;ethane;methylcyclopentane.
What is the SMILES notation for 1-chloro-2-methylbenzene;ethane;methylcyclopentane?
The canonical SMILES for 1-chloro-2-methylbenzene;ethane;methylcyclopentane is CC.CC1CCCC1.Cc1ccccc1Cl.
What is the InChIKey of 1-chloro-2-methylbenzene;ethane;methylcyclopentane?
The InChIKey is PCJRVQFQRCOQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.C6H12.C2H6/c1-6-4-2-3-5-7(6)8;1-6-4-2-3-5-6;1-2/h2-5H,1H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of 1-chloro-2-methylbenzene;ethane;methylcyclopentane?
1-chloro-2-methylbenzene;ethane;methylcyclopentane has a molecular weight of 240.82 g/mol, XLogP of 5.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methylbenzene;ethane;methylcyclopentane is sourced from PubChem (CID 164862819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).