About 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane
2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane (PubChem CID 166081294) has the molecular formula C21H34Cl2O
and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane.
Molecular Properties
| Compound Name | 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane |
| PubChem CID | 166081294 |
| Molecular Formula | C21H34Cl2O |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane |
| SMILES | CC.CC.CC.COc1cccc(C)c1Cl.Cc1ccccc1Cl |
| InChI | InChI=1S/C8H9ClO.C7H7Cl.3C2H6/c1-6-4-3-5-7(10-2)8(6)9;1-6-4-2-3-5-7(6)8;3*1-2/h3-5H,1-2H3;2-5H,1H3;3*1-2H3 |
| InChIKey | ZGMWHTLWNSOSOL-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane?
The IUPAC name of 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane (CID 166081294) is 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane.
What is the SMILES notation for 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane?
The canonical SMILES for 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane is CC.CC.CC.COc1cccc(C)c1Cl.Cc1ccccc1Cl.
What is the InChIKey of 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane?
The InChIKey is ZGMWHTLWNSOSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C7H7Cl.3C2H6/c1-6-4-3-5-7(10-2)8(6)9;1-6-4-2-3-5-7(6)8;3*1-2/h3-5H,1-2H3;2-5H,1H3;3*1-2H3.
What are the key properties of 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane?
2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane has a molecular weight of 373.41 g/mol, XLogP of 8.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-methoxy-3-methylbenzene;1-chloro-2-methylbenzene;ethane is sourced from PubChem (CID 166081294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).