C15H11F3N4O — CID 60609345
1-(3-cyanoanilino)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 60609345) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 1-(3-cyanoanilino)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-cyanoanilino)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 60609345 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(3-cyanoanilino)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1cccc(NNC(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)12-6-1-2-7-13(12)20-14(23)22-21-11-5-3-4-10(8-11)9-19/h1-8,21H,(H2,20,22,23) |
| InChIKey | ICZBJHMUNUHECX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|