C20H19F3N4O2 — CID 17425595
N-(3-cyanophenyl)-2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]propanamide (PubChem CID 17425595) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]propanamide.
| Compound Name | N-(3-cyanophenyl)-2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]propanamide |
|---|---|
| PubChem CID | 17425595 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-(3-cyanophenyl)-2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]propanamide |
| SMILES | CC(C(=O)Nc1cccc(C#N)c1)N(C)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O2/c1-13(19(29)25-15-7-5-6-14(10-15)11-24)27(2)12-18(28)26-17-9-4-3-8-16(17)20(21,22)23/h3-10,13H,12H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | JBVCHMDXDQXCSA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |