C14H16F3N3O — CID 78889854
2-[1-cyanopropan-2-yl(methyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 78889854) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[1-cyanopropan-2-yl(methyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[1-cyanopropan-2-yl(methyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78889854 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[1-cyanopropan-2-yl(methyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(CC#N)N(C)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O/c1-10(7-8-18)20(2)9-13(21)19-12-6-4-3-5-11(12)14(15,16)17/h3-6,10H,7,9H2,1-2H3,(H,19,21) |
| InChIKey | MBMFFSUXTYPAHT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |