C16H19F3N4O2 — CID 34691947
N-(2-cyanoethyl)-2-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetamide (PubChem CID 34691947) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 34691947 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-[ethyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetamide |
| SMILES | CCN(CC(=O)NCCC#N)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O2/c1-2-23(10-14(24)21-9-5-8-20)11-15(25)22-13-7-4-3-6-12(13)16(17,18)19/h3-4,6-7H,2,5,9-11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | YJSNVFZTWJCZAV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|