C14H16ClF3N2O — CID 78832350
2-[[(E)-3-chloroprop-2-enyl]-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 78832350) has the molecular formula C14H16ClF3N2O and a molecular weight of 320.74 g/mol. Its IUPAC name is 2-[[(E)-3-chloroprop-2-enyl]-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[(E)-3-chloroprop-2-enyl]-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78832350 |
| Molecular Formula | C14H16ClF3N2O |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[[(E)-3-chloroprop-2-enyl]-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(C/C=C/Cl)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3N2O/c1-2-20(9-5-8-15)10-13(21)19-12-7-4-3-6-11(12)14(16,17)18/h3-8H,2,9-10H2,1H3,(H,19,21)/b8-5+ |
| InChIKey | XIKLUJZCJPFZKU-VMPITWQZSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |