C19H18F6N2O — CID 24506960
2-[ethyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 24506960) has the molecular formula C19H18F6N2O and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-[ethyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[ethyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24506960 |
| Molecular Formula | C19H18F6N2O |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[ethyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F6N2O/c1-2-27(11-13-7-9-14(10-8-13)18(20,21)22)12-17(28)26-16-6-4-3-5-15(16)19(23,24)25/h3-10H,2,11-12H2,1H3,(H,26,28) |
| InChIKey | SXMGJWRJTMHWFU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |