C21H18F6N2O2 — CID 26356752
(E)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 26356752) has the molecular formula C21H18F6N2O2 and a molecular weight of 444.38 g/mol. Its IUPAC name is (E)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26356752 |
| Molecular Formula | C21H18F6N2O2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F6N2O2/c1-2-29(13-18(30)28-17-6-4-3-5-16(17)21(25,26)27)19(31)12-9-14-7-10-15(11-8-14)20(22,23)24/h3-12H,2,13H2,1H3,(H,28,30)/b12-9+ |
| InChIKey | AUJMFAJECPQWCM-FMIVXFBMSA-N |
| XLogP | 5.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|