C21H19F5N2O3 — CID 26356583
(E)-3-[4-(difluoromethoxy)phenyl]-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide (PubChem CID 26356583) has the molecular formula C21H19F5N2O3 and a molecular weight of 442.38 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26356583 |
| Molecular Formula | C21H19F5N2O3 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H19F5N2O3/c1-2-28(13-18(29)27-17-6-4-3-5-16(17)21(24,25)26)19(30)12-9-14-7-10-15(11-8-14)31-20(22)23/h3-12,20H,2,13H2,1H3,(H,27,29)/b12-9+ |
| InChIKey | ZOUZDQMGCGMPMX-FMIVXFBMSA-N |
| XLogP | 4.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|