C17H25F3N2O3 — CID 78827764
2-[ethyl-(2-hydroxy-3-propan-2-yloxypropyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 78827764) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[ethyl-(2-hydroxy-3-propan-2-yloxypropyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[ethyl-(2-hydroxy-3-propan-2-yloxypropyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78827764 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[ethyl-(2-hydroxy-3-propan-2-yloxypropyl)amino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)CC(O)COC(C)C |
| InChI | InChI=1S/C17H25F3N2O3/c1-4-22(9-13(23)11-25-12(2)3)10-16(24)21-15-8-6-5-7-14(15)17(18,19)20/h5-8,12-13,23H,4,9-11H2,1-3H3,(H,21,24) |
| InChIKey | TXCISKPNOAIWLG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |