C15H10F3N3S — CID 127058276
1-(4-cyanophenyl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 127058276) has the molecular formula C15H10F3N3S and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(4-cyanophenyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 127058276 |
| Molecular Formula | C15H10F3N3S |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | N#Cc1ccc(NC(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F3N3S/c16-15(17,18)12-3-1-2-4-13(12)21-14(22)20-11-7-5-10(9-19)6-8-11/h1-8H,(H2,20,21,22) |
| InChIKey | FXRNUYLPHHGSLD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|