C22H14F4N4OS — CID 73053171
2-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide (PubChem CID 73053171) has the molecular formula C22H14F4N4OS and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 73053171 |
| Molecular Formula | C22H14F4N4OS |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylamino]-N-(4-fluorophenyl)benzamide |
| SMILES | N#Cc1ccc(NC(=S)Nc2ccccc2C(=O)Nc2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H14F4N4OS/c23-14-6-9-15(10-7-14)28-20(31)17-3-1-2-4-19(17)30-21(32)29-16-8-5-13(12-27)18(11-16)22(24,25)26/h1-11H,(H,28,31)(H2,29,30,32) |
| InChIKey | CWSVFECDADGGJM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|