C11H10F3N3S — CID 116509077
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-ethylthiourea (PubChem CID 116509077) has the molecular formula C11H10F3N3S and a molecular weight of 273.28 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-ethylthiourea.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 116509077 |
| Molecular Formula | C11H10F3N3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F3N3S/c1-2-16-10(18)17-8-4-3-7(6-15)9(5-8)11(12,13)14/h3-5H,2H2,1H3,(H2,16,17,18) |
| InChIKey | RNAQLIAZKOHDFC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|