C12H12F3N3O2S — CID 171675223
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(1,3-dihydroxypropan-2-yl)thiourea (PubChem CID 171675223) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(1,3-dihydroxypropan-2-yl)thiourea.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(1,3-dihydroxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 171675223 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(1,3-dihydroxypropan-2-yl)thiourea |
| SMILES | N#Cc1ccc(NC(=S)NC(CO)CO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O2S/c13-12(14,15)10-3-8(2-1-7(10)4-16)17-11(21)18-9(5-19)6-20/h1-3,9,19-20H,5-6H2,(H2,17,18,21) |
| InChIKey | CLBGQRPYNSQSRU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|