C10H8F3N3S — CID 116509070
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-methylthiourea (PubChem CID 116509070) has the molecular formula C10H8F3N3S and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-methylthiourea.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 116509070 |
| Molecular Formula | C10H8F3N3S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3N3S/c1-15-9(17)16-7-3-2-6(5-14)8(4-7)10(11,12)13/h2-4H,1H3,(H2,15,16,17) |
| InChIKey | HWWDSGSVMYUADL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|