C10H10F3N3 — CID 83016971
4-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzonitrile (PubChem CID 83016971) has the molecular formula C10H10F3N3 and a molecular weight of 229.21 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 83016971 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CN(C)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3N3/c1-16(2)15-8-4-3-7(6-14)9(5-8)10(11,12)13/h3-5,15H,1-2H3 |
| InChIKey | YBBOHGABXUMBCO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|