C18H18F3N3 — CID 56583938
4-[[2-(dimethylamino)-2-phenylethyl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 56583938) has the molecular formula C18H18F3N3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)-2-phenylethyl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[2-(dimethylamino)-2-phenylethyl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 56583938 |
| Molecular Formula | C18H18F3N3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[[2-(dimethylamino)-2-phenylethyl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CN(C)C(CNc1ccc(C#N)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H18F3N3/c1-24(2)17(13-6-4-3-5-7-13)12-23-15-9-8-14(11-22)16(10-15)18(19,20)21/h3-10,17,23H,12H2,1-2H3 |
| InChIKey | VCLNUGFJAUYNBG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |