C21H17F3N2S — CID 19651956
1-benzhydryl-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 19651956) has the molecular formula C21H17F3N2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-benzhydryl-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19651956 |
| Molecular Formula | C21H17F3N2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-benzhydryl-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccccc1NC(=S)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17F3N2S/c22-21(23,24)17-13-7-8-14-18(17)25-20(27)26-19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H2,25,26,27) |
| InChIKey | JVRZWILMSPWRLP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|