C19H19N3O2 — CID 108519483
N'-(2-tert-butylphenyl)-N-(4-cyanophenyl)oxamide (PubChem CID 108519483) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N'-(2-tert-butylphenyl)-N-(4-cyanophenyl)oxamide.
| Compound Name | N'-(2-tert-butylphenyl)-N-(4-cyanophenyl)oxamide |
|---|---|
| PubChem CID | 108519483 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N'-(2-tert-butylphenyl)-N-(4-cyanophenyl)oxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-19(2,3)15-6-4-5-7-16(15)22-18(24)17(23)21-14-10-8-13(12-20)9-11-14/h4-11H,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | BPPMXTBOJHFKAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|