C16H11F3N2O2S2 — CID 2824099
1-(1,1-dioxo-1-benzothiophen-6-yl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2824099) has the molecular formula C16H11F3N2O2S2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2824099 |
| Molecular Formula | C16H11F3N2O2S2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 1-(1,1-dioxo-1-benzothiophen-6-yl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=S1(=O)C=Cc2ccc(NC(=S)Nc3ccccc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H11F3N2O2S2/c17-16(18,19)12-3-1-2-4-13(12)21-15(24)20-11-6-5-10-7-8-25(22,23)14(10)9-11/h1-9H,(H2,20,21,24) |
| InChIKey | LZTIFQMQKNQCAB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|