C9H9F4N3O2S — CID 88971956
2,2,2-trifluoro-N'-(3-fluoro-4-methylsulfonylanilino)ethanimidamide (PubChem CID 88971956) has the molecular formula C9H9F4N3O2S and a molecular weight of 299.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-(3-fluoro-4-methylsulfonylanilino)ethanimidamide.
| Compound Name | 2,2,2-trifluoro-N'-(3-fluoro-4-methylsulfonylanilino)ethanimidamide |
|---|---|
| PubChem CID | 88971956 |
| Molecular Formula | C9H9F4N3O2S |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2,2,2-trifluoro-N'-(3-fluoro-4-methylsulfonylanilino)ethanimidamide |
| SMILES | CS(=O)(=O)c1ccc(N/N=C(\N)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H9F4N3O2S/c1-19(17,18)7-3-2-5(4-6(7)10)15-16-8(14)9(11,12)13/h2-4,15H,1H3,(H2,14,16) |
| InChIKey | WCLHSNORRNAWII-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|