C20H14F10N3O3+ — CID 166006192
N-(3-methylimidazol-3-ium-1-yl)-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboxamide (PubChem CID 166006192) has the molecular formula C20H14F10N3O3+ and a molecular weight of 534.33 g/mol. Its IUPAC name is N-(3-methylimidazol-3-ium-1-yl)-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboxamide.
| Compound Name | N-(3-methylimidazol-3-ium-1-yl)-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 166006192 |
| Molecular Formula | C20H14F10N3O3+ |
| Molecular Weight | 534.33 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | N-(3-methylimidazol-3-ium-1-yl)-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboxamide |
| SMILES | C[n+]1ccn(NC(=O)c2ccc3cc(OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)ccc3c2)c1 |
| InChI | InChI=1S/C20H13F10N3O3/c1-32-6-7-33(10-32)31-15(34)13-3-2-12-9-14(5-4-11(12)8-13)35-17(22,23)16(21)36-20(29,30)18(24,25)19(26,27)28/h2-10,16H,1H3/p+1 |
| InChIKey | SJUSGFAFOKAOHI-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|