C19H13F4N3O2 — CID 167706291
N-pyridazin-1-ium-1-yl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate (PubChem CID 167706291) has the molecular formula C19H13F4N3O2 and a molecular weight of 391.32 g/mol. Its IUPAC name is N-pyridazin-1-ium-1-yl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate.
| Compound Name | N-pyridazin-1-ium-1-yl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 167706291 |
| Molecular Formula | C19H13F4N3O2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-pyridazin-1-ium-1-yl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate |
| SMILES | [O-]C(=N[n+]1ccccn1)c1ccc(-c2ccc(OC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H13F4N3O2/c20-18(21)19(22,23)28-16-9-7-14(8-10-16)13-3-5-15(6-4-13)17(27)25-26-12-2-1-11-24-26/h1-12,18H |
| InChIKey | ZDNNMUROTJRFRA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|