C18H13F4N3O — CID 139724258
4-methyl-2-[6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]pyrimidine (PubChem CID 139724258) has the molecular formula C18H13F4N3O and a molecular weight of 363.31 g/mol. Its IUPAC name is 4-methyl-2-[6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]pyrimidine.
| Compound Name | 4-methyl-2-[6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]pyrimidine |
|---|---|
| PubChem CID | 139724258 |
| Molecular Formula | C18H13F4N3O |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-methyl-2-[6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]pyrimidine |
| SMILES | Cc1ccnc(-c2cccc(-c3ccc(OC(F)(F)C(F)F)cc3)n2)n1 |
| InChI | InChI=1S/C18H13F4N3O/c1-11-9-10-23-16(24-11)15-4-2-3-14(25-15)12-5-7-13(8-6-12)26-18(21,22)17(19)20/h2-10,17H,1H3 |
| InChIKey | MZMISJRKRIVNCM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|