C19H15ClF4N4O2 — CID 166006163
(1Z)-3-chloro-N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate (PubChem CID 166006163) has the molecular formula C19H15ClF4N4O2 and a molecular weight of 442.80 g/mol. Its IUPAC name is (1Z)-3-chloro-N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate.
| Compound Name | (1Z)-3-chloro-N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 166006163 |
| Molecular Formula | C19H15ClF4N4O2 |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (1Z)-3-chloro-N-(1-ethyl-1,2,4-triazol-4-ium-4-yl)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenecarboximidate |
| SMILES | CCn1c[n+](/N=C(\[O-])c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)c(Cl)c2)cn1 |
| InChI | InChI=1S/C19H15ClF4N4O2/c1-2-27-11-28(10-25-27)26-17(29)13-5-8-15(16(20)9-13)12-3-6-14(7-4-12)30-19(23,24)18(21)22/h3-11,18H,2H2,1H3 |
| InChIKey | VJAYZGHWDKVNCX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|