C14H16F4O2 — CID 146008885
2,2-dimethyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one (PubChem CID 146008885) has the molecular formula C14H16F4O2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 146008885 |
| Molecular Formula | C14H16F4O2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2,2-dimethyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
| SMILES | CCC(C)(C)C(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C14H16F4O2/c1-4-13(2,3)11(19)9-5-7-10(8-6-9)20-14(17,18)12(15)16/h5-8,12H,4H2,1-3H3 |
| InChIKey | ARXSXLMGOZVKOF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|