C19H32O4Si — CID 70700519
methyl 7-(5-oxo-3-triethylsilyloxycyclopenten-1-yl)hept-5-enoate (PubChem CID 70700519) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is methyl 7-(5-oxo-3-triethylsilyloxycyclopenten-1-yl)hept-5-enoate.
| Compound Name | methyl 7-(5-oxo-3-triethylsilyloxycyclopenten-1-yl)hept-5-enoate |
|---|---|
| PubChem CID | 70700519 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl 7-(5-oxo-3-triethylsilyloxycyclopenten-1-yl)hept-5-enoate |
| SMILES | CC[Si](CC)(CC)OC1C=C(CC=CCCCC(=O)OC)C(=O)C1 |
| InChI | InChI=1S/C19H32O4Si/c1-5-24(6-2,7-3)23-17-14-16(18(20)15-17)12-10-8-9-11-13-19(21)22-4/h8,10,14,17H,5-7,9,11-13,15H2,1-4H3 |
| InChIKey | OOQNWYMXCDLSSN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|