C15H22O2 — CID 118357261
(4R)-4-methyl-2-[(Z)-7-oxonon-2-enyl]cyclopent-2-en-1-one (PubChem CID 118357261) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4R)-4-methyl-2-[(Z)-7-oxonon-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4R)-4-methyl-2-[(Z)-7-oxonon-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 118357261 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4R)-4-methyl-2-[(Z)-7-oxonon-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCC(=O)CCC/C=C\CC1=C[C@H](C)CC1=O |
| InChI | InChI=1S/C15H22O2/c1-3-14(16)9-7-5-4-6-8-13-10-12(2)11-15(13)17/h4,6,10,12H,3,5,7-9,11H2,1-2H3/b6-4-/t12-/m0/s1 |
| InChIKey | BIEWXAIXLQIZDY-RNZFLTOJSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|