C23H36O — CID 123703858
13-methyldocosa-7,10,13,16,19-pentaen-3-one (PubChem CID 123703858) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is 13-methyldocosa-7,10,13,16,19-pentaen-3-one.
| Compound Name | 13-methyldocosa-7,10,13,16,19-pentaen-3-one |
|---|---|
| PubChem CID | 123703858 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 13-methyldocosa-7,10,13,16,19-pentaen-3-one |
| SMILES | CCC=CCC=CCC=C(C)CC=CCC=CCCCC(=O)CC |
| InChI | InChI=1S/C23H36O/c1-4-6-7-8-10-13-16-19-22(3)20-17-14-11-9-12-15-18-21-23(24)5-2/h6-7,9-10,12-14,17,19H,4-5,8,11,15-16,18,20-21H2,1-3H3 |
| InChIKey | MTNSOJQGKGIBOF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|