C21H32O2S — CID 123431287
sulfanyl 11-methylicosa-5,8,11,14,17-pentaenoate (PubChem CID 123431287) has the molecular formula C21H32O2S and a molecular weight of 348.55 g/mol. Its IUPAC name is sulfanyl 11-methylicosa-5,8,11,14,17-pentaenoate.
| Compound Name | sulfanyl 11-methylicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 123431287 |
| Molecular Formula | C21H32O2S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | sulfanyl 11-methylicosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=C(C)CC=CCC=CCCCC(=O)OS |
| InChI | InChI=1S/C21H32O2S/c1-3-4-5-6-8-11-14-17-20(2)18-15-12-9-7-10-13-16-19-21(22)23-24/h4-5,7-8,10-12,15,17,24H,3,6,9,13-14,16,18-19H2,1-2H3 |
| InChIKey | BEOJWUKNTWHWEB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|