C25H26O5 — CID 146028549
benzhydryl 2-[(3S)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]acetate (PubChem CID 146028549) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is benzhydryl 2-[(3S)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]acetate.
| Compound Name | benzhydryl 2-[(3S)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]acetate |
|---|---|
| PubChem CID | 146028549 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | benzhydryl 2-[(3S)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]acetate |
| SMILES | O=C(CC1=C[C@@H](OC2CCCCO2)CC1=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26O5/c26-22-17-21(29-24-13-7-8-14-28-24)15-20(22)16-23(27)30-25(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,15,21,24-25H,7-8,13-14,16-17H2/t21-,24?/m1/s1 |
| InChIKey | KWCXLBBTCAUKNV-CILPGNKCSA-N |
| XLogP | 4.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |