C19H22O3 — CID 71209539
(1R,2R)-2-(oxan-2-yloxy)-1,2-diphenylethanol (PubChem CID 71209539) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1R,2R)-2-(oxan-2-yloxy)-1,2-diphenylethanol.
| Compound Name | (1R,2R)-2-(oxan-2-yloxy)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 71209539 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1R,2R)-2-(oxan-2-yloxy)-1,2-diphenylethanol |
| SMILES | O[C@H](c1ccccc1)[C@H](OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H22O3/c20-18(15-9-3-1-4-10-15)19(16-11-5-2-6-12-16)22-17-13-7-8-14-21-17/h1-6,9-12,17-20H,7-8,13-14H2/t17?,18-,19-/m1/s1 |
| InChIKey | RYGUJRJIPQOUKX-OMKBGSMGSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |