C17H25NO5 — CID 118237094
benzyl-[(2R,3R)-1-hydroxy-3-(oxan-2-yloxy)butan-2-yl]carbamic acid (PubChem CID 118237094) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is benzyl-[(2R,3R)-1-hydroxy-3-(oxan-2-yloxy)butan-2-yl]carbamic acid.
| Compound Name | benzyl-[(2R,3R)-1-hydroxy-3-(oxan-2-yloxy)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118237094 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | benzyl-[(2R,3R)-1-hydroxy-3-(oxan-2-yloxy)butan-2-yl]carbamic acid |
| SMILES | C[C@@H](OC1CCCCO1)[C@@H](CO)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25NO5/c1-13(23-16-9-5-6-10-22-16)15(12-19)18(17(20)21)11-14-7-3-2-4-8-14/h2-4,7-8,13,15-16,19H,5-6,9-12H2,1H3,(H,20,21)/t13-,15-,16?/m1/s1 |
| InChIKey | WKJZWHGLZRCWLW-CWSLVUQWSA-N |
| XLogP | 2.46 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |