C25H33NO4 — CID 68826511
methyl 2-[[(2R)-2-(oxan-2-yloxy)-3-phenylpropyl]-[(1R)-1-phenylethyl]amino]acetate (PubChem CID 68826511) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-(oxan-2-yloxy)-3-phenylpropyl]-[(1R)-1-phenylethyl]amino]acetate.
| Compound Name | methyl 2-[[(2R)-2-(oxan-2-yloxy)-3-phenylpropyl]-[(1R)-1-phenylethyl]amino]acetate |
|---|---|
| PubChem CID | 68826511 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | methyl 2-[[(2R)-2-(oxan-2-yloxy)-3-phenylpropyl]-[(1R)-1-phenylethyl]amino]acetate |
| SMILES | COC(=O)CN(C[C@@H](Cc1ccccc1)OC1CCCCO1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H33NO4/c1-20(22-13-7-4-8-14-22)26(19-24(27)28-2)18-23(17-21-11-5-3-6-12-21)30-25-15-9-10-16-29-25/h3-8,11-14,20,23,25H,9-10,15-19H2,1-2H3/t20-,23-,25?/m1/s1 |
| InChIKey | QHNPNMNTDJYKNP-IIMRKJFHSA-N |
| XLogP | 4.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |