C16H24O4 — CID 15450471
(2S)-3-[3-(methoxymethyl)phenyl]-2-(oxan-2-yloxy)propan-1-ol (PubChem CID 15450471) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2S)-3-[3-(methoxymethyl)phenyl]-2-(oxan-2-yloxy)propan-1-ol.
| Compound Name | (2S)-3-[3-(methoxymethyl)phenyl]-2-(oxan-2-yloxy)propan-1-ol |
|---|---|
| PubChem CID | 15450471 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2S)-3-[3-(methoxymethyl)phenyl]-2-(oxan-2-yloxy)propan-1-ol |
| SMILES | COCc1cccc(C[C@@H](CO)OC2CCCCO2)c1 |
| InChI | InChI=1S/C16H24O4/c1-18-12-14-6-4-5-13(9-14)10-15(11-17)20-16-7-2-3-8-19-16/h4-6,9,15-17H,2-3,7-8,10-12H2,1H3/t15-,16?/m0/s1 |
| InChIKey | ITUOYKGMKWSRNC-VYRBHSGPSA-N |
| XLogP | 2.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |