C19H28N2O5 — CID 14678933
(2S,3R)-3-acetamido-N-methoxy-N-methyl-2-(oxan-2-yloxy)-4-phenylbutanamide (PubChem CID 14678933) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S,3R)-3-acetamido-N-methoxy-N-methyl-2-(oxan-2-yloxy)-4-phenylbutanamide.
| Compound Name | (2S,3R)-3-acetamido-N-methoxy-N-methyl-2-(oxan-2-yloxy)-4-phenylbutanamide |
|---|---|
| PubChem CID | 14678933 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2S,3R)-3-acetamido-N-methoxy-N-methyl-2-(oxan-2-yloxy)-4-phenylbutanamide |
| SMILES | CON(C)C(=O)[C@@H](OC1CCCCO1)[C@@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C19H28N2O5/c1-14(22)20-16(13-15-9-5-4-6-10-15)18(19(23)21(2)24-3)26-17-11-7-8-12-25-17/h4-6,9-10,16-18H,7-8,11-13H2,1-3H3,(H,20,22)/t16-,17?,18+/m1/s1 |
| InChIKey | IFAJEKNAFDHRMU-BLAYRMRBSA-N |
| XLogP | 1.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|