C32H52O7 — CID 70540149
(Z)-7-[(1R,2R,5S)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70540149) has the molecular formula C32H52O7 and a molecular weight of 548.76 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70540149 |
| Molecular Formula | C32H52O7 |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)[C@@H](/C=C/[C@H]1C(=O)C[C@H](OC2CCCCO2)[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C32H52O7/c1-4-5-20-32(2,3)28(39-31-17-11-13-22-37-31)19-18-24-25(14-8-6-7-9-15-29(34)35)27(23-26(24)33)38-30-16-10-12-21-36-30/h6,8,18-19,24-25,27-28,30-31H,4-5,7,9-17,20-23H2,1-3H3,(H,34,35)/b8-6-,19-18+/t24-,25-,27+,28-,30?,31?/m1/s1 |
| InChIKey | BQYKVLLSNLYRFS-CUIKTAAXSA-N |
| XLogP | 6.99 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|